C15H29F6NO3S — CID 122481488
1,1,2,2,3,3-hexafluoroheptane-1-sulfonate;tetraethylazanium (PubChem CID 122481488) has the molecular formula C15H29F6NO3S and a molecular weight of 417.46 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoroheptane-1-sulfonate;tetraethylazanium.
| Compound Name | 1,1,2,2,3,3-hexafluoroheptane-1-sulfonate;tetraethylazanium |
|---|---|
| PubChem CID | 122481488 |
| Molecular Formula | C15H29F6NO3S |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoroheptane-1-sulfonate;tetraethylazanium |
| SMILES | CCCCC(F)(F)C(F)(F)C(F)(F)S(=O)(=O)[O-].CC[N+](CC)(CC)CC |
| InChI | InChI=1S/C8H20N.C7H10F6O3S/c1-5-9(6-2,7-3)8-4;1-2-3-4-5(8,9)6(10,11)7(12,13)17(14,15)16/h5-8H2,1-4H3;2-4H2,1H3,(H,14,15,16)/q+1;/p-1 |
| InChIKey | BYBKKJAXTYLYBA-UHFFFAOYSA-M |
| XLogP | 4.47 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|