C7H9F6KO3S — CID 122481336
potassium 1,1,2,2,3,3-hexafluoroheptane-1-sulfonate (PubChem CID 122481336) has the molecular formula C7H9F6KO3S and a molecular weight of 326.30 g/mol. Its IUPAC name is potassium 1,1,2,2,3,3-hexafluoroheptane-1-sulfonate.
| Compound Name | potassium 1,1,2,2,3,3-hexafluoroheptane-1-sulfonate |
|---|---|
| PubChem CID | 122481336 |
| Molecular Formula | C7H9F6KO3S |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | potassium 1,1,2,2,3,3-hexafluoroheptane-1-sulfonate |
| SMILES | CCCCC(F)(F)C(F)(F)C(F)(F)S(=O)(=O)[O-].[K+] |
| InChI | InChI=1S/C7H10F6O3S.K/c1-2-3-4-5(8,9)6(10,11)7(12,13)17(14,15)16;/h2-4H2,1H3,(H,14,15,16);/q;+1/p-1 |
| InChIKey | BPNZZDNSBFUTSV-UHFFFAOYSA-M |
| XLogP | -0.41 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|