C11H16ClF6KO3S — CID 23676035
potassium 5-chloro-1,1,2,2,3,3-hexafluoroundecane-1-sulfonate (PubChem CID 23676035) has the molecular formula C11H16ClF6KO3S and a molecular weight of 416.85 g/mol. Its IUPAC name is potassium 5-chloro-1,1,2,2,3,3-hexafluoroundecane-1-sulfonate.
| Compound Name | potassium 5-chloro-1,1,2,2,3,3-hexafluoroundecane-1-sulfonate |
|---|---|
| PubChem CID | 23676035 |
| Molecular Formula | C11H16ClF6KO3S |
| Molecular Weight | 416.85 g/mol |
| Exact Mass | 416.00 |
| IUPAC Name | potassium 5-chloro-1,1,2,2,3,3-hexafluoroundecane-1-sulfonate |
| SMILES | CCCCCCC(Cl)CC(F)(F)C(F)(F)C(F)(F)S(=O)(=O)[O-].[K+] |
| InChI | InChI=1S/C11H17ClF6O3S.K/c1-2-3-4-5-6-8(12)7-9(13,14)10(15,16)11(17,18)22(19,20)21;/h8H,2-7H2,1H3,(H,19,20,21);/q;+1/p-1 |
| InChIKey | YCCWQKLBAQUYLN-UHFFFAOYSA-M |
| XLogP | 1.37 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.85 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|