C19H37F6NO3S — CID 122481434
1,1,2,2,3,3-hexafluoroundecane-1-sulfonate;tetraethylazanium (PubChem CID 122481434) has the molecular formula C19H37F6NO3S and a molecular weight of 473.56 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoroundecane-1-sulfonate;tetraethylazanium.
| Compound Name | 1,1,2,2,3,3-hexafluoroundecane-1-sulfonate;tetraethylazanium |
|---|---|
| PubChem CID | 122481434 |
| Molecular Formula | C19H37F6NO3S |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoroundecane-1-sulfonate;tetraethylazanium |
| SMILES | CCCCCCCCC(F)(F)C(F)(F)C(F)(F)S(=O)(=O)[O-].CC[N+](CC)(CC)CC |
| InChI | InChI=1S/C11H18F6O3S.C8H20N/c1-2-3-4-5-6-7-8-9(12,13)10(14,15)11(16,17)21(18,19)20;1-5-9(6-2,7-3)8-4/h2-8H2,1H3,(H,18,19,20);5-8H2,1-4H3/q;+1/p-1 |
| InChIKey | DDVFSCKBIPSVRE-UHFFFAOYSA-M |
| XLogP | 6.03 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|