C6H9F4NaO3S — CID 122481287
sodium 1,1,2,2-tetrafluorohexane-1-sulfonate (PubChem CID 122481287) has the molecular formula C6H9F4NaO3S and a molecular weight of 260.18 g/mol. Its IUPAC name is sodium 1,1,2,2-tetrafluorohexane-1-sulfonate.
| Compound Name | sodium 1,1,2,2-tetrafluorohexane-1-sulfonate |
|---|---|
| PubChem CID | 122481287 |
| Molecular Formula | C6H9F4NaO3S |
| Molecular Weight | 260.18 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | sodium 1,1,2,2-tetrafluorohexane-1-sulfonate |
| SMILES | CCCCC(F)(F)C(F)(F)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C6H10F4O3S.Na/c1-2-3-4-5(7,8)6(9,10)14(11,12)13;/h2-4H2,1H3,(H,11,12,13);/q;+1/p-1 |
| InChIKey | RRYVFAQBMXUFHB-UHFFFAOYSA-M |
| XLogP | -1.05 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.18 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|