C16H30F7NO3S — CID 141492168
1,1,2,2,8,8,8-heptafluorooctane-1-sulfonate;tetraethylazanium (PubChem CID 141492168) has the molecular formula C16H30F7NO3S and a molecular weight of 449.47 g/mol. Its IUPAC name is 1,1,2,2,8,8,8-heptafluorooctane-1-sulfonate;tetraethylazanium.
| Compound Name | 1,1,2,2,8,8,8-heptafluorooctane-1-sulfonate;tetraethylazanium |
|---|---|
| PubChem CID | 141492168 |
| Molecular Formula | C16H30F7NO3S |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 1,1,2,2,8,8,8-heptafluorooctane-1-sulfonate;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.O=S(=O)([O-])C(F)(F)C(F)(F)CCCCCC(F)(F)F |
| InChI | InChI=1S/C8H11F7O3S.C8H20N/c9-6(10,8(14,15)19(16,17)18)4-2-1-3-5-7(11,12)13;1-5-9(6-2,7-3)8-4/h1-5H2,(H,16,17,18);5-8H2,1-4H3/q;+1/p-1 |
| InChIKey | IUCZLXAHPUDDOI-UHFFFAOYSA-M |
| XLogP | 5.16 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|