C12H20F9NO3S — CID 141492551
dimethylazanium;1,1,2,2,3,3,10,10,10-nonafluorodecane-1-sulfonate (PubChem CID 141492551) has the molecular formula C12H20F9NO3S and a molecular weight of 429.35 g/mol. Its IUPAC name is dimethylazanium;1,1,2,2,3,3,10,10,10-nonafluorodecane-1-sulfonate.
| Compound Name | dimethylazanium;1,1,2,2,3,3,10,10,10-nonafluorodecane-1-sulfonate |
|---|---|
| PubChem CID | 141492551 |
| Molecular Formula | C12H20F9NO3S |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | dimethylazanium;1,1,2,2,3,3,10,10,10-nonafluorodecane-1-sulfonate |
| SMILES | C[NH2+]C.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)CCCCCCC(F)(F)F |
| InChI | InChI=1S/C10H13F9O3S.C2H7N/c11-7(12,5-3-1-2-4-6-8(13,14)15)9(16,17)10(18,19)23(20,21)22;1-3-2/h1-6H2,(H,20,21,22);3H,1-2H3 |
| InChIKey | JZOZSBIAOCUIRA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|