C12H16F13NO3S — CID 141491998
dimethylazanium;1,1,2,2,3,3,4,4,5,5,10,10,10-tridecafluorodecane-1-sulfonate (PubChem CID 141491998) has the molecular formula C12H16F13NO3S and a molecular weight of 501.31 g/mol. Its IUPAC name is dimethylazanium;1,1,2,2,3,3,4,4,5,5,10,10,10-tridecafluorodecane-1-sulfonate.
| Compound Name | dimethylazanium;1,1,2,2,3,3,4,4,5,5,10,10,10-tridecafluorodecane-1-sulfonate |
|---|---|
| PubChem CID | 141491998 |
| Molecular Formula | C12H16F13NO3S |
| Molecular Weight | 501.31 g/mol |
| Exact Mass | 501.06 |
| IUPAC Name | dimethylazanium;1,1,2,2,3,3,4,4,5,5,10,10,10-tridecafluorodecane-1-sulfonate |
| SMILES | C[NH2+]C.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCCC(F)(F)F |
| InChI | InChI=1S/C10H9F13O3S.C2H7N/c11-5(12,3-1-2-4-6(13,14)15)7(16,17)8(18,19)9(20,21)10(22,23)27(24,25)26;1-3-2/h1-4H2,(H,24,25,26);3H,1-2H3 |
| InChIKey | QKJIYVPINKEKAW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|