C8H7F10KO3S — CID 122480837
potassium 1,1,2,2,3,3,4,4,5,5-decafluorooctane-1-sulfonate (PubChem CID 122480837) has the molecular formula C8H7F10KO3S and a molecular weight of 412.29 g/mol. Its IUPAC name is potassium 1,1,2,2,3,3,4,4,5,5-decafluorooctane-1-sulfonate.
| Compound Name | potassium 1,1,2,2,3,3,4,4,5,5-decafluorooctane-1-sulfonate |
|---|---|
| PubChem CID | 122480837 |
| Molecular Formula | C8H7F10KO3S |
| Molecular Weight | 412.29 g/mol |
| Exact Mass | 411.96 |
| IUPAC Name | potassium 1,1,2,2,3,3,4,4,5,5-decafluorooctane-1-sulfonate |
| SMILES | CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)[O-].[K+] |
| InChI | InChI=1S/C8H8F10O3S.K/c1-2-3-4(9,10)5(11,12)6(13,14)7(15,16)8(17,18)22(19,20)21;/h2-3H2,1H3,(H,19,20,21);/q;+1/p-1 |
| InChIKey | DZFIVUXXLAKLAS-UHFFFAOYSA-M |
| XLogP | 0.47 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.29 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|