C11H18F9NO3S — CID 141491973
azanium 1,1,2,2,3,3,11,11,11-nonafluoroundecane-1-sulfonate (PubChem CID 141491973) has the molecular formula C11H18F9NO3S and a molecular weight of 415.32 g/mol. Its IUPAC name is azanium 1,1,2,2,3,3,11,11,11-nonafluoroundecane-1-sulfonate.
| Compound Name | azanium 1,1,2,2,3,3,11,11,11-nonafluoroundecane-1-sulfonate |
|---|---|
| PubChem CID | 141491973 |
| Molecular Formula | C11H18F9NO3S |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | azanium 1,1,2,2,3,3,11,11,11-nonafluoroundecane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)CCCCCCCC(F)(F)F.[NH4+] |
| InChI | InChI=1S/C11H15F9O3S.H3N/c12-8(13,10(17,18)11(19,20)24(21,22)23)6-4-2-1-3-5-7-9(14,15)16;/h1-7H2,(H,21,22,23);1H3 |
| InChIKey | LOTPIWORJHTALO-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|