C16H29F9NO3S+ — CID 175360661
1,1,2,2,3,3,8,8,8-nonafluorooctane-1-sulfonic acid;tetraethylazanium (PubChem CID 175360661) has the molecular formula C16H29F9NO3S+ and a molecular weight of 486.46 g/mol. Its IUPAC name is 1,1,2,2,3,3,8,8,8-nonafluorooctane-1-sulfonic acid;tetraethylazanium.
| Compound Name | 1,1,2,2,3,3,8,8,8-nonafluorooctane-1-sulfonic acid;tetraethylazanium |
|---|---|
| PubChem CID | 175360661 |
| Molecular Formula | C16H29F9NO3S+ |
| Molecular Weight | 486.46 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 1,1,2,2,3,3,8,8,8-nonafluorooctane-1-sulfonic acid;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)CCCCC(F)(F)F |
| InChI | InChI=1S/C8H9F9O3S.C8H20N/c9-5(10,3-1-2-4-6(11,12)13)7(14,15)8(16,17)21(18,19)20;1-5-9(6-2,7-3)8-4/h1-4H2,(H,18,19,20);5-8H2,1-4H3/q;+1 |
| InChIKey | BUMJEPMOWODEOV-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.46 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|