C14H16F15NO3S — CID 175165468
1,1,2,2,3,3,4,4,5,5,6,6,11,11,11-pentadecafluoroundecane-1-sulfonic acid;prop-2-en-1-amine (PubChem CID 175165468) has the molecular formula C14H16F15NO3S and a molecular weight of 563.32 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,11,11,11-pentadecafluoroundecane-1-sulfonic acid;prop-2-en-1-amine.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,11,11,11-pentadecafluoroundecane-1-sulfonic acid;prop-2-en-1-amine |
|---|---|
| PubChem CID | 175165468 |
| Molecular Formula | C14H16F15NO3S |
| Molecular Weight | 563.32 g/mol |
| Exact Mass | 563.06 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,11,11,11-pentadecafluoroundecane-1-sulfonic acid;prop-2-en-1-amine |
| SMILES | C=CCN.O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCCC(F)(F)F |
| InChI | InChI=1S/C11H9F15O3S.C3H7N/c12-5(13,3-1-2-4-6(14,15)16)7(17,18)8(19,20)9(21,22)10(23,24)11(25,26)30(27,28)29;1-2-3-4/h1-4H2,(H,27,28,29);2H,1,3-4H2 |
| InChIKey | ZWDIJPLQHZKSKR-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.32 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|