C16H12F17NO3S — CID 171930591
1,1,2,2,3,3,4,4,5,5,6,6,7,7,11,11,11-heptadecafluoroundecane-1-sulfonic acid;pyridine (PubChem CID 171930591) has the molecular formula C16H12F17NO3S and a molecular weight of 621.31 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,11,11,11-heptadecafluoroundecane-1-sulfonic acid;pyridine.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,11,11,11-heptadecafluoroundecane-1-sulfonic acid;pyridine |
|---|---|
| PubChem CID | 171930591 |
| Molecular Formula | C16H12F17NO3S |
| Molecular Weight | 621.31 g/mol |
| Exact Mass | 621.03 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,11,11,11-heptadecafluoroundecane-1-sulfonic acid;pyridine |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCC(F)(F)F.c1ccncc1 |
| InChI | InChI=1S/C11H7F17O3S.C5H5N/c12-4(13,2-1-3-5(14,15)16)6(17,18)7(19,20)8(21,22)9(23,24)10(25,26)11(27,28)32(29,30)31;1-2-4-6-5-3-1/h1-3H2,(H,29,30,31);1-5H |
| InChIKey | IGJVYNWYGBTKIC-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.31 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|