C8H13F4O4S- — CID 58037006
1,1,2,2-tetrafluoro-8-hydroxyoctane-1-sulfonate (PubChem CID 58037006) has the molecular formula C8H13F4O4S- and a molecular weight of 281.25 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-8-hydroxyoctane-1-sulfonate.
| Compound Name | 1,1,2,2-tetrafluoro-8-hydroxyoctane-1-sulfonate |
|---|---|
| PubChem CID | 58037006 |
| Molecular Formula | C8H13F4O4S- |
| Molecular Weight | 281.25 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 1,1,2,2-tetrafluoro-8-hydroxyoctane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)CCCCCCO |
| InChI | InChI=1S/C8H14F4O4S/c9-7(10,5-3-1-2-4-6-13)8(11,12)17(14,15)16/h13H,1-6H2,(H,14,15,16)/p-1 |
| InChIKey | HAAYJMXDNFKWLW-UHFFFAOYSA-M |
| XLogP | 1.70 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|