C12H17F4O7S- — CID 140679957
1,1,2,2-tetrafluoro-6-[2-(2-hydroxyethoxycarbonyl)prop-2-enoxy]hexane-1-sulfonate (PubChem CID 140679957) has the molecular formula C12H17F4O7S- and a molecular weight of 381.32 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-6-[2-(2-hydroxyethoxycarbonyl)prop-2-enoxy]hexane-1-sulfonate.
| Compound Name | 1,1,2,2-tetrafluoro-6-[2-(2-hydroxyethoxycarbonyl)prop-2-enoxy]hexane-1-sulfonate |
|---|---|
| PubChem CID | 140679957 |
| Molecular Formula | C12H17F4O7S- |
| Molecular Weight | 381.32 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 1,1,2,2-tetrafluoro-6-[2-(2-hydroxyethoxycarbonyl)prop-2-enoxy]hexane-1-sulfonate |
| SMILES | C=C(COCCCCC(F)(F)C(F)(F)S(=O)(=O)[O-])C(=O)OCCO |
| InChI | InChI=1S/C12H18F4O7S/c1-9(10(18)23-7-5-17)8-22-6-3-2-4-11(13,14)12(15,16)24(19,20)21/h17H,1-8H2,(H,19,20,21)/p-1 |
| InChIKey | ONWRODCQQKTTMR-UHFFFAOYSA-M |
| XLogP | 1.04 |
| TPSA | 112.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.32 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|