C15H21F7O7S — CID 118231762
1,1,2,2-tetrafluoro-6-[2-(4,4,4-trifluoro-3-hydroxy-3-methylbutan-2-yl)oxycarbonylprop-2-enoxy]hexane-1-sulfonic acid (PubChem CID 118231762) has the molecular formula C15H21F7O7S and a molecular weight of 478.38 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-6-[2-(4,4,4-trifluoro-3-hydroxy-3-methylbutan-2-yl)oxycarbonylprop-2-enoxy]hexane-1-sulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-6-[2-(4,4,4-trifluoro-3-hydroxy-3-methylbutan-2-yl)oxycarbonylprop-2-enoxy]hexane-1-sulfonic acid |
|---|---|
| PubChem CID | 118231762 |
| Molecular Formula | C15H21F7O7S |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 1,1,2,2-tetrafluoro-6-[2-(4,4,4-trifluoro-3-hydroxy-3-methylbutan-2-yl)oxycarbonylprop-2-enoxy]hexane-1-sulfonic acid |
| SMILES | C=C(COCCCCC(F)(F)C(F)(F)S(=O)(=O)O)C(=O)OC(C)C(C)(O)C(F)(F)F |
| InChI | InChI=1S/C15H21F7O7S/c1-9(11(23)29-10(2)12(3,24)14(18,19)20)8-28-7-5-4-6-13(16,17)15(21,22)30(25,26)27/h10,24H,1,4-8H2,2-3H3,(H,25,26,27) |
| InChIKey | RBCZRGSYCUFGLV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|