C19H27F7O7S — CID 118231735
4-[2-(1-cyclohexyl-4,4,4-trifluoro-3-hydroxy-3-methylbutan-2-yl)oxycarbonylprop-2-enoxy]-1,1,2,2-tetrafluorobutane-1-sulfonic acid (PubChem CID 118231735) has the molecular formula C19H27F7O7S and a molecular weight of 532.47 g/mol. Its IUPAC name is 4-[2-(1-cyclohexyl-4,4,4-trifluoro-3-hydroxy-3-methylbutan-2-yl)oxycarbonylprop-2-enoxy]-1,1,2,2-tetrafluorobutane-1-sulfonic acid.
| Compound Name | 4-[2-(1-cyclohexyl-4,4,4-trifluoro-3-hydroxy-3-methylbutan-2-yl)oxycarbonylprop-2-enoxy]-1,1,2,2-tetrafluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 118231735 |
| Molecular Formula | C19H27F7O7S |
| Molecular Weight | 532.47 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | 4-[2-(1-cyclohexyl-4,4,4-trifluoro-3-hydroxy-3-methylbutan-2-yl)oxycarbonylprop-2-enoxy]-1,1,2,2-tetrafluorobutane-1-sulfonic acid |
| SMILES | C=C(COCCC(F)(F)C(F)(F)S(=O)(=O)O)C(=O)OC(CC1CCCCC1)C(C)(O)C(F)(F)F |
| InChI | InChI=1S/C19H27F7O7S/c1-12(11-32-9-8-17(20,21)19(25,26)34(29,30)31)15(27)33-14(16(2,28)18(22,23)24)10-13-6-4-3-5-7-13/h13-14,28H,1,3-11H2,2H3,(H,29,30,31) |
| InChIKey | HNWCUAQPFBPYQP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|