C14H22F2O6S — CID 89433588
3-[2-(1-ethylcyclopentyl)oxycarbonylprop-2-enoxy]-1,1-difluoropropane-1-sulfonic acid (PubChem CID 89433588) has the molecular formula C14H22F2O6S and a molecular weight of 356.39 g/mol. Its IUPAC name is 3-[2-(1-ethylcyclopentyl)oxycarbonylprop-2-enoxy]-1,1-difluoropropane-1-sulfonic acid.
| Compound Name | 3-[2-(1-ethylcyclopentyl)oxycarbonylprop-2-enoxy]-1,1-difluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 89433588 |
| Molecular Formula | C14H22F2O6S |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 3-[2-(1-ethylcyclopentyl)oxycarbonylprop-2-enoxy]-1,1-difluoropropane-1-sulfonic acid |
| SMILES | C=C(COCCC(F)(F)S(=O)(=O)O)C(=O)OC1(CC)CCCC1 |
| InChI | InChI=1S/C14H22F2O6S/c1-3-13(6-4-5-7-13)22-12(17)11(2)10-21-9-8-14(15,16)23(18,19)20/h2-10H2,1H3,(H,18,19,20) |
| InChIKey | DQFVQSLCBIDHMT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|