C9H11F4O6S- — CID 123152358
1,1,2,2-tetrafluoro-4-(2-methoxycarbonylprop-2-enoxy)butane-1-sulfonate (PubChem CID 123152358) has the molecular formula C9H11F4O6S- and a molecular weight of 323.24 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-4-(2-methoxycarbonylprop-2-enoxy)butane-1-sulfonate.
| Compound Name | 1,1,2,2-tetrafluoro-4-(2-methoxycarbonylprop-2-enoxy)butane-1-sulfonate |
|---|---|
| PubChem CID | 123152358 |
| Molecular Formula | C9H11F4O6S- |
| Molecular Weight | 323.24 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 1,1,2,2-tetrafluoro-4-(2-methoxycarbonylprop-2-enoxy)butane-1-sulfonate |
| SMILES | C=C(COCCC(F)(F)C(F)(F)S(=O)(=O)[O-])C(=O)OC |
| InChI | InChI=1S/C9H12F4O6S/c1-6(7(14)18-2)5-19-4-3-8(10,11)9(12,13)20(15,16)17/h1,3-5H2,2H3,(H,15,16,17)/p-1 |
| InChIKey | NCHPYBAFQJVZRH-UHFFFAOYSA-M |
| XLogP | 0.90 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.24 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|