C12H13F4O8S- — CID 140679944
1,1,2,2-tetrafluoro-4-[2-(2-oxooxolan-3-yl)oxycarbonylprop-2-enoxy]butane-1-sulfonate (PubChem CID 140679944) has the molecular formula C12H13F4O8S- and a molecular weight of 393.29 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-4-[2-(2-oxooxolan-3-yl)oxycarbonylprop-2-enoxy]butane-1-sulfonate.
| Compound Name | 1,1,2,2-tetrafluoro-4-[2-(2-oxooxolan-3-yl)oxycarbonylprop-2-enoxy]butane-1-sulfonate |
|---|---|
| PubChem CID | 140679944 |
| Molecular Formula | C12H13F4O8S- |
| Molecular Weight | 393.29 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | 1,1,2,2-tetrafluoro-4-[2-(2-oxooxolan-3-yl)oxycarbonylprop-2-enoxy]butane-1-sulfonate |
| SMILES | C=C(COCCC(F)(F)C(F)(F)S(=O)(=O)[O-])C(=O)OC1CCOC1=O |
| InChI | InChI=1S/C12H14F4O8S/c1-7(9(17)24-8-2-4-23-10(8)18)6-22-5-3-11(13,14)12(15,16)25(19,20)21/h8H,1-6H2,(H,19,20,21)/p-1 |
| InChIKey | DSUINHFMGJJOFY-UHFFFAOYSA-M |
| XLogP | 0.58 |
| TPSA | 119.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.29 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|