C10H10F2O9S — CID 90328909
1,1-difluoro-2-oxo-2-[2-(2-oxooxolan-3-yl)oxycarbonylprop-2-enoxy]ethanesulfonic acid (PubChem CID 90328909) has the molecular formula C10H10F2O9S and a molecular weight of 344.24 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-[2-(2-oxooxolan-3-yl)oxycarbonylprop-2-enoxy]ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-oxo-2-[2-(2-oxooxolan-3-yl)oxycarbonylprop-2-enoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 90328909 |
| Molecular Formula | C10H10F2O9S |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-[2-(2-oxooxolan-3-yl)oxycarbonylprop-2-enoxy]ethanesulfonic acid |
| SMILES | C=C(COC(=O)C(F)(F)S(=O)(=O)O)C(=O)OC1CCOC1=O |
| InChI | InChI=1S/C10H10F2O9S/c1-5(7(13)21-6-2-3-19-8(6)14)4-20-9(15)10(11,12)22(16,17)18/h6H,1-4H2,(H,16,17,18) |
| InChIKey | OTIKJYQHVUNERS-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|