C8H10F2O7S — CID 129190016
1,1-difluoro-2-oxo-2-[(6-oxooxan-3-yl)methoxy]ethanesulfonic acid (PubChem CID 129190016) has the molecular formula C8H10F2O7S and a molecular weight of 288.22 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-[(6-oxooxan-3-yl)methoxy]ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-oxo-2-[(6-oxooxan-3-yl)methoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 129190016 |
| Molecular Formula | C8H10F2O7S |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-[(6-oxooxan-3-yl)methoxy]ethanesulfonic acid |
| SMILES | O=C1CCC(COC(=O)C(F)(F)S(=O)(=O)O)CO1 |
| InChI | InChI=1S/C8H10F2O7S/c9-8(10,18(13,14)15)7(12)17-4-5-1-2-6(11)16-3-5/h5H,1-4H2,(H,13,14,15) |
| InChIKey | PPUWYWNBHGEUAK-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|