C11H12F2O8S — CID 88997909
1,1-difluoro-2-[2-(3-methylidene-2-oxocyclohexyl)oxy-2-oxoethoxy]-2-oxoethanesulfonic acid (PubChem CID 88997909) has the molecular formula C11H12F2O8S and a molecular weight of 342.27 g/mol. Its IUPAC name is 1,1-difluoro-2-[2-(3-methylidene-2-oxocyclohexyl)oxy-2-oxoethoxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[2-(3-methylidene-2-oxocyclohexyl)oxy-2-oxoethoxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 88997909 |
| Molecular Formula | C11H12F2O8S |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | 1,1-difluoro-2-[2-(3-methylidene-2-oxocyclohexyl)oxy-2-oxoethoxy]-2-oxoethanesulfonic acid |
| SMILES | C=C1CCCC(OC(=O)COC(=O)C(F)(F)S(=O)(=O)O)C1=O |
| InChI | InChI=1S/C11H12F2O8S/c1-6-3-2-4-7(9(6)15)21-8(14)5-20-10(16)11(12,13)22(17,18)19/h7H,1-5H2,(H,17,18,19) |
| InChIKey | KQZNSBRPUZETJV-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|