C8H10F2O8S2 — CID 89007067
1,1-difluoro-2-[2-(1,4-oxathian-2-yloxy)-2-oxoethoxy]-2-oxoethanesulfonic acid (PubChem CID 89007067) has the molecular formula C8H10F2O8S2 and a molecular weight of 336.29 g/mol. Its IUPAC name is 1,1-difluoro-2-[2-(1,4-oxathian-2-yloxy)-2-oxoethoxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[2-(1,4-oxathian-2-yloxy)-2-oxoethoxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 89007067 |
| Molecular Formula | C8H10F2O8S2 |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 335.98 |
| IUPAC Name | 1,1-difluoro-2-[2-(1,4-oxathian-2-yloxy)-2-oxoethoxy]-2-oxoethanesulfonic acid |
| SMILES | O=C(COC(=O)C(F)(F)S(=O)(=O)O)OC1CSCCO1 |
| InChI | InChI=1S/C8H10F2O8S2/c9-8(10,20(13,14)15)7(12)17-3-5(11)18-6-4-19-2-1-16-6/h6H,1-4H2,(H,13,14,15) |
| InChIKey | OMFVOKOWKKIQBP-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|