C11H12F2O10S2 — CID 89000422
2-[2-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl)oxy]-2-oxoethoxy]-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 89000422) has the molecular formula C11H12F2O10S2 and a molecular weight of 406.34 g/mol. Its IUPAC name is 2-[2-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl)oxy]-2-oxoethoxy]-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-[2-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl)oxy]-2-oxoethoxy]-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 89000422 |
| Molecular Formula | C11H12F2O10S2 |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 405.98 |
| IUPAC Name | 2-[2-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl)oxy]-2-oxoethoxy]-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | O=C(COC(=O)C(F)(F)S(=O)(=O)O)OC1C2CC3OS(=O)(=O)C1C3C2 |
| InChI | InChI=1S/C11H12F2O10S2/c12-11(13,25(18,19)20)10(15)21-3-7(14)22-8-4-1-5-6(2-4)23-24(16,17)9(5)8/h4-6,8-9H,1-3H2,(H,18,19,20) |
| InChIKey | LNMFOHIKCHYBAI-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 150.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|