C14H18INO7S — CID 126664112
[2-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-2-oxoethyl] (2S)-2-(aziridin-2-yl)-2-iodopropanoate (PubChem CID 126664112) has the molecular formula C14H18INO7S and a molecular weight of 471.27 g/mol. Its IUPAC name is [2-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-2-oxoethyl] (2S)-2-(aziridin-2-yl)-2-iodopropanoate.
| Compound Name | [2-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-2-oxoethyl] (2S)-2-(aziridin-2-yl)-2-iodopropanoate |
|---|---|
| PubChem CID | 126664112 |
| Molecular Formula | C14H18INO7S |
| Molecular Weight | 471.27 g/mol |
| Exact Mass | 470.98 |
| IUPAC Name | [2-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-2-oxoethyl] (2S)-2-(aziridin-2-yl)-2-iodopropanoate |
| SMILES | C[C@@](I)(C(=O)OCC(=O)OC1C2CC3C1OS(=O)(=O)C3C2)C1CN1 |
| InChI | InChI=1S/C14H18INO7S/c1-14(15,9-4-16-9)13(18)21-5-10(17)22-11-6-2-7-8(3-6)24(19,20)23-12(7)11/h6-9,11-12,16H,2-5H2,1H3/t6?,7?,8?,9?,11?,12?,14-/m0/s1 |
| InChIKey | QVMWCPOKPCCFPO-OZUSSTPLSA-N |
| XLogP | -0.26 |
| TPSA | 117.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.27 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|