C11H15ClO5S — CID 58264880
(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.3.1.03,7]decan-2-yl) 3-chloropropanoate (PubChem CID 58264880) has the molecular formula C11H15ClO5S and a molecular weight of 294.76 g/mol. Its IUPAC name is (5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.3.1.03,7]decan-2-yl) 3-chloropropanoate.
| Compound Name | (5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.3.1.03,7]decan-2-yl) 3-chloropropanoate |
|---|---|
| PubChem CID | 58264880 |
| Molecular Formula | C11H15ClO5S |
| Molecular Weight | 294.76 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | (5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.3.1.03,7]decan-2-yl) 3-chloropropanoate |
| SMILES | O=C(CCCl)OC1C2CCC3C1OS(=O)(=O)C3C2 |
| InChI | InChI=1S/C11H15ClO5S/c12-4-3-9(13)16-10-6-1-2-7-8(5-6)18(14,15)17-11(7)10/h6-8,10-11H,1-5H2 |
| InChIKey | BXEFHRLOLRGAKD-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.76 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|