C15H20O7S — CID 58264896
[3-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.3.1.03,7]decan-2-yl)oxy]-3-oxopropyl] 2-methylprop-2-enoate (PubChem CID 58264896) has the molecular formula C15H20O7S and a molecular weight of 344.39 g/mol. Its IUPAC name is [3-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.3.1.03,7]decan-2-yl)oxy]-3-oxopropyl] 2-methylprop-2-enoate.
| Compound Name | [3-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.3.1.03,7]decan-2-yl)oxy]-3-oxopropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58264896 |
| Molecular Formula | C15H20O7S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | [3-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.3.1.03,7]decan-2-yl)oxy]-3-oxopropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(=O)OC1C2CCC3C1OS(=O)(=O)C3C2 |
| InChI | InChI=1S/C15H20O7S/c1-8(2)15(17)20-6-5-12(16)21-13-9-3-4-10-11(7-9)23(18,19)22-14(10)13/h9-11,13-14H,1,3-7H2,2H3 |
| InChIKey | YQAZGNUMFJIVHQ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|