C21H31NO5 — CID 158058700
(4-tert-butyl-5-oxo-4-azatricyclo[4.3.1.03,7]decan-2-yl) 4-(2-methylprop-2-enoyloxy)butanoate (PubChem CID 158058700) has the molecular formula C21H31NO5 and a molecular weight of 377.48 g/mol. Its IUPAC name is (4-tert-butyl-5-oxo-4-azatricyclo[4.3.1.03,7]decan-2-yl) 4-(2-methylprop-2-enoyloxy)butanoate.
| Compound Name | (4-tert-butyl-5-oxo-4-azatricyclo[4.3.1.03,7]decan-2-yl) 4-(2-methylprop-2-enoyloxy)butanoate |
|---|---|
| PubChem CID | 158058700 |
| Molecular Formula | C21H31NO5 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | (4-tert-butyl-5-oxo-4-azatricyclo[4.3.1.03,7]decan-2-yl) 4-(2-methylprop-2-enoyloxy)butanoate |
| SMILES | C=C(C)C(=O)OCCCC(=O)OC1C2CCC3C(C2)C(=O)N(C(C)(C)C)C31 |
| InChI | InChI=1S/C21H31NO5/c1-12(2)20(25)26-10-6-7-16(23)27-18-13-8-9-14-15(11-13)19(24)22(17(14)18)21(3,4)5/h13-15,17-18H,1,6-11H2,2-5H3 |
| InChIKey | MLMVILRKRLXHCW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|