C21H33NO5 — CID 159904334
(6-tert-butyl-3,8-dimethyl-7-oxo-6-azabicyclo[3.2.1]octan-4-yl) 4-(2-methylprop-2-enoyloxy)butanoate (PubChem CID 159904334) has the molecular formula C21H33NO5 and a molecular weight of 379.50 g/mol. Its IUPAC name is (6-tert-butyl-3,8-dimethyl-7-oxo-6-azabicyclo[3.2.1]octan-4-yl) 4-(2-methylprop-2-enoyloxy)butanoate.
| Compound Name | (6-tert-butyl-3,8-dimethyl-7-oxo-6-azabicyclo[3.2.1]octan-4-yl) 4-(2-methylprop-2-enoyloxy)butanoate |
|---|---|
| PubChem CID | 159904334 |
| Molecular Formula | C21H33NO5 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | (6-tert-butyl-3,8-dimethyl-7-oxo-6-azabicyclo[3.2.1]octan-4-yl) 4-(2-methylprop-2-enoyloxy)butanoate |
| SMILES | C=C(C)C(=O)OCCCC(=O)OC1C(C)CC2C(=O)N(C(C)(C)C)C1C2C |
| InChI | InChI=1S/C21H33NO5/c1-12(2)20(25)26-10-8-9-16(23)27-18-13(3)11-15-14(4)17(18)22(19(15)24)21(5,6)7/h13-15,17-18H,1,8-11H2,2-7H3 |
| InChIKey | QABFPAKWXUEWFT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|