C33H48O13S — CID 134546024
[(4S,5R)-4,5-bis[5-(2-methylprop-2-enoyloxy)pentanoyloxy]oxan-2-yl]sulfanylmethyl 5-(2-methylprop-2-enoyloxy)pentanoate (PubChem CID 134546024) has the molecular formula C33H48O13S and a molecular weight of 684.80 g/mol. Its IUPAC name is [(4S,5R)-4,5-bis[5-(2-methylprop-2-enoyloxy)pentanoyloxy]oxan-2-yl]sulfanylmethyl 5-(2-methylprop-2-enoyloxy)pentanoate.
| Compound Name | [(4S,5R)-4,5-bis[5-(2-methylprop-2-enoyloxy)pentanoyloxy]oxan-2-yl]sulfanylmethyl 5-(2-methylprop-2-enoyloxy)pentanoate |
|---|---|
| PubChem CID | 134546024 |
| Molecular Formula | C33H48O13S |
| Molecular Weight | 684.80 g/mol |
| Exact Mass | 684.28 |
| IUPAC Name | [(4S,5R)-4,5-bis[5-(2-methylprop-2-enoyloxy)pentanoyloxy]oxan-2-yl]sulfanylmethyl 5-(2-methylprop-2-enoyloxy)pentanoate |
| SMILES | C=C(C)C(=O)OCCCCC(=O)OCSC1C[C@H](OC(=O)CCCCOC(=O)C(=C)C)[C@H](OC(=O)CCCCOC(=O)C(=C)C)CO1 |
| InChI | InChI=1S/C33H48O13S/c1-22(2)31(37)40-16-10-7-13-27(34)44-21-47-30-19-25(45-28(35)14-8-11-17-41-32(38)23(3)4)26(20-43-30)46-29(36)15-9-12-18-42-33(39)24(5)6/h25-26,30H,1,3,5,7-21H2,2,4,6H3/t25-,26+,30?/m0/s1 |
| InChIKey | OGGPRNPPKLLRLA-RSWNPTKKSA-N |
| XLogP | 4.66 |
| TPSA | 167.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.80 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|