C41H59NO17 — CID 126514906
[(3R,4S,5R)-4,5-bis[5-(2-methylprop-2-enoyloxy)pentanoyloxy]-6-[5-(2-methylprop-2-enoyloxy)pentanoyloxyamino]oxan-3-yl] 5-(2-methylprop-2-enoyloxy)pentanoate (PubChem CID 126514906) has the molecular formula C41H59NO17 and a molecular weight of 837.91 g/mol. Its IUPAC name is [(3R,4S,5R)-4,5-bis[5-(2-methylprop-2-enoyloxy)pentanoyloxy]-6-[5-(2-methylprop-2-enoyloxy)pentanoyloxyamino]oxan-3-yl] 5-(2-methylprop-2-enoyloxy)pentanoate.
| Compound Name | [(3R,4S,5R)-4,5-bis[5-(2-methylprop-2-enoyloxy)pentanoyloxy]-6-[5-(2-methylprop-2-enoyloxy)pentanoyloxyamino]oxan-3-yl] 5-(2-methylprop-2-enoyloxy)pentanoate |
|---|---|
| PubChem CID | 126514906 |
| Molecular Formula | C41H59NO17 |
| Molecular Weight | 837.91 g/mol |
| Exact Mass | 837.38 |
| IUPAC Name | [(3R,4S,5R)-4,5-bis[5-(2-methylprop-2-enoyloxy)pentanoyloxy]-6-[5-(2-methylprop-2-enoyloxy)pentanoyloxyamino]oxan-3-yl] 5-(2-methylprop-2-enoyloxy)pentanoate |
| SMILES | C=C(C)C(=O)OCCCCC(=O)ONC1OC[C@@H](OC(=O)CCCCOC(=O)C(=C)C)[C@H](OC(=O)CCCCOC(=O)C(=C)C)[C@H]1OC(=O)CCCCOC(=O)C(=C)C |
| InChI | InChI=1S/C41H59NO17/c1-26(2)38(47)51-21-13-9-17-31(43)56-30-25-55-37(42-59-34(46)20-12-16-24-54-41(50)29(7)8)36(58-33(45)19-11-15-23-53-40(49)28(5)6)35(30)57-32(44)18-10-14-22-52-39(48)27(3)4/h30,35-37,42H,1,3,5,7,9-25H2,2,4,6,8H3/t30-,35+,36-,37?/m1/s1 |
| InChIKey | KNGSOKQECDNOBC-LYEIHUJMSA-N |
| XLogP | 4.28 |
| TPSA | 231.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.91 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|