C22H33NO7 — CID 87748178
[4-[bis[3-(2-methylprop-2-enoyloxy)propyl]amino]-4-oxobutyl] 2-methylprop-2-enoate (PubChem CID 87748178) has the molecular formula C22H33NO7 and a molecular weight of 423.51 g/mol. Its IUPAC name is [4-[bis[3-(2-methylprop-2-enoyloxy)propyl]amino]-4-oxobutyl] 2-methylprop-2-enoate.
| Compound Name | [4-[bis[3-(2-methylprop-2-enoyloxy)propyl]amino]-4-oxobutyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87748178 |
| Molecular Formula | C22H33NO7 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | [4-[bis[3-(2-methylprop-2-enoyloxy)propyl]amino]-4-oxobutyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCC(=O)N(CCCOC(=O)C(=C)C)CCCOC(=O)C(=C)C |
| InChI | InChI=1S/C22H33NO7/c1-16(2)20(25)28-13-7-10-19(24)23(11-8-14-29-21(26)17(3)4)12-9-15-30-22(27)18(5)6/h1,3,5,7-15H2,2,4,6H3 |
| InChIKey | NUHDXPLMNXOZBB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|