C24H40N2O8 — CID 139632024
2-[ethoxycarbonyl-[6-[ethoxycarbonyl-[2-(2-methylprop-2-enoyloxy)ethyl]amino]hexyl]amino]ethyl 2-methylprop-2-enoate (PubChem CID 139632024) has the molecular formula C24H40N2O8 and a molecular weight of 484.59 g/mol. Its IUPAC name is 2-[ethoxycarbonyl-[6-[ethoxycarbonyl-[2-(2-methylprop-2-enoyloxy)ethyl]amino]hexyl]amino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[ethoxycarbonyl-[6-[ethoxycarbonyl-[2-(2-methylprop-2-enoyloxy)ethyl]amino]hexyl]amino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139632024 |
| Molecular Formula | C24H40N2O8 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | 2-[ethoxycarbonyl-[6-[ethoxycarbonyl-[2-(2-methylprop-2-enoyloxy)ethyl]amino]hexyl]amino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCN(CCCCCCN(CCOC(=O)C(=C)C)C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C24H40N2O8/c1-7-31-23(29)25(15-17-33-21(27)19(3)4)13-11-9-10-12-14-26(24(30)32-8-2)16-18-34-22(28)20(5)6/h3,5,7-18H2,1-2,4,6H3 |
| InChIKey | QCTZNAHXNDPAEJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|