About (3,8-dimethyl-7,7-dioxo-6-oxa-7λ6-thiabicyclo[3.2.1]octan-4-yl) 2-chloroacetate
(3,8-dimethyl-7,7-dioxo-6-oxa-7λ6-thiabicyclo[3.2.1]octan-4-yl) 2-chloroacetate (PubChem CID 58264853) has the molecular formula C10H15ClO5S
and a molecular weight of 282.75 g/mol. Its IUPAC name is (3,8-dimethyl-7,7-dioxo-6-oxa-7λ6-thiabicyclo[3.2.1]octan-4-yl) 2-chloroacetate.
Molecular Properties
| Compound Name | (3,8-dimethyl-7,7-dioxo-6-oxa-7λ6-thiabicyclo[3.2.1]octan-4-yl) 2-chloroacetate |
| PubChem CID | 58264853 |
| Molecular Formula | C10H15ClO5S |
| Molecular Weight | 282.75 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | (3,8-dimethyl-7,7-dioxo-6-oxa-7λ6-thiabicyclo[3.2.1]octan-4-yl) 2-chloroacetate |
| SMILES | CC1CC2C(C)C(OS2(=O)=O)C1OC(=O)CCl |
| InChI | InChI=1S/C10H15ClO5S/c1-5-3-7-6(2)10(16-17(7,13)14)9(5)15-8(12)4-11/h5-7,9-10H,3-4H2,1-2H3 |
| InChIKey | QPASWOCJEBGIOV-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.75 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3,8-dimethyl-7,7-dioxo-6-oxa-7λ6-thiabicyclo[3.2.1]octan-4-yl) 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,8-dimethyl-7,7-dioxo-6-oxa-7λ6-thiabicyclo[3.2.1]octan-4-yl) 2-chloroacetate?
The IUPAC name of (3,8-dimethyl-7,7-dioxo-6-oxa-7λ6-thiabicyclo[3.2.1]octan-4-yl) 2-chloroacetate (CID 58264853) is (3,8-dimethyl-7,7-dioxo-6-oxa-7λ6-thiabicyclo[3.2.1]octan-4-yl) 2-chloroacetate.
What is the SMILES notation for (3,8-dimethyl-7,7-dioxo-6-oxa-7λ6-thiabicyclo[3.2.1]octan-4-yl) 2-chloroacetate?
The canonical SMILES for (3,8-dimethyl-7,7-dioxo-6-oxa-7λ6-thiabicyclo[3.2.1]octan-4-yl) 2-chloroacetate is CC1CC2C(C)C(OS2(=O)=O)C1OC(=O)CCl.
What is the InChIKey of (3,8-dimethyl-7,7-dioxo-6-oxa-7λ6-thiabicyclo[3.2.1]octan-4-yl) 2-chloroacetate?
The InChIKey is QPASWOCJEBGIOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15ClO5S/c1-5-3-7-6(2)10(16-17(7,13)14)9(5)15-8(12)4-11/h5-7,9-10H,3-4H2,1-2H3.
What are the key properties of (3,8-dimethyl-7,7-dioxo-6-oxa-7λ6-thiabicyclo[3.2.1]octan-4-yl) 2-chloroacetate?
(3,8-dimethyl-7,7-dioxo-6-oxa-7λ6-thiabicyclo[3.2.1]octan-4-yl) 2-chloroacetate has a molecular weight of 282.75 g/mol, XLogP of 0.91, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3,8-dimethyl-7,7-dioxo-6-oxa-7λ6-thiabicyclo[3.2.1]octan-4-yl) 2-chloroacetate is sourced from PubChem (CID 58264853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).