C10H15ClO5S — CID 58264853
(3,8-dimethyl-7,7-dioxo-6-oxa-7λ6-thiabicyclo[3.2.1]octan-4-yl) 2-chloroacetate (PubChem CID 58264853) has the molecular formula C10H15ClO5S and a molecular weight of 282.75 g/mol. Its IUPAC name is (3,8-dimethyl-7,7-dioxo-6-oxa-7λ6-thiabicyclo[3.2.1]octan-4-yl) 2-chloroacetate.
| Compound Name | (3,8-dimethyl-7,7-dioxo-6-oxa-7λ6-thiabicyclo[3.2.1]octan-4-yl) 2-chloroacetate |
|---|---|
| PubChem CID | 58264853 |
| Molecular Formula | C10H15ClO5S |
| Molecular Weight | 282.75 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | (3,8-dimethyl-7,7-dioxo-6-oxa-7λ6-thiabicyclo[3.2.1]octan-4-yl) 2-chloroacetate |
| SMILES | CC1CC2C(C)C(OS2(=O)=O)C1OC(=O)CCl |
| InChI | InChI=1S/C10H15ClO5S/c1-5-3-7-6(2)10(16-17(7,13)14)9(5)15-8(12)4-11/h5-7,9-10H,3-4H2,1-2H3 |
| InChIKey | QPASWOCJEBGIOV-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.75 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|