C10H11ClO5S — CID 148880861
(5,5-dioxo-4-oxa-5λ6-thiatetracyclo[4.3.1.01,8.03,10]decan-2-yl) 2-chloroacetate (PubChem CID 148880861) has the molecular formula C10H11ClO5S and a molecular weight of 278.71 g/mol. Its IUPAC name is (5,5-dioxo-4-oxa-5λ6-thiatetracyclo[4.3.1.01,8.03,10]decan-2-yl) 2-chloroacetate.
| Compound Name | (5,5-dioxo-4-oxa-5λ6-thiatetracyclo[4.3.1.01,8.03,10]decan-2-yl) 2-chloroacetate |
|---|---|
| PubChem CID | 148880861 |
| Molecular Formula | C10H11ClO5S |
| Molecular Weight | 278.71 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | (5,5-dioxo-4-oxa-5λ6-thiatetracyclo[4.3.1.01,8.03,10]decan-2-yl) 2-chloroacetate |
| SMILES | O=C(CCl)OC1C2OS(=O)(=O)C3CC4CC41C23 |
| InChI | InChI=1S/C10H11ClO5S/c11-3-6(12)15-9-8-7-5(17(13,14)16-8)1-4-2-10(4,7)9/h4-5,7-9H,1-3H2 |
| InChIKey | PDANWTQLMNJNFK-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.71 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|