C15H21NO6S — CID 59623413
(8,8-dimethyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl) 2-(2-methylprop-2-enoylamino)acetate (PubChem CID 59623413) has the molecular formula C15H21NO6S and a molecular weight of 343.40 g/mol. Its IUPAC name is (8,8-dimethyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl) 2-(2-methylprop-2-enoylamino)acetate.
| Compound Name | (8,8-dimethyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl) 2-(2-methylprop-2-enoylamino)acetate |
|---|---|
| PubChem CID | 59623413 |
| Molecular Formula | C15H21NO6S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | (8,8-dimethyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl) 2-(2-methylprop-2-enoylamino)acetate |
| SMILES | C=C(C)C(=O)NCC(=O)OC1C2OS(=O)(=O)C3CC1C(C)(C)C23 |
| InChI | InChI=1S/C15H21NO6S/c1-7(2)14(18)16-6-10(17)21-12-8-5-9-11(15(8,3)4)13(12)22-23(9,19)20/h8-9,11-13H,1,5-6H2,2-4H3,(H,16,18) |
| InChIKey | TYLKICNDCQQEDE-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|