C14H19NO6S — CID 59623205
(7-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) 2-(2-methylprop-2-enoylamino)acetate (PubChem CID 59623205) has the molecular formula C14H19NO6S and a molecular weight of 329.37 g/mol. Its IUPAC name is (7-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) 2-(2-methylprop-2-enoylamino)acetate.
| Compound Name | (7-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) 2-(2-methylprop-2-enoylamino)acetate |
|---|---|
| PubChem CID | 59623205 |
| Molecular Formula | C14H19NO6S |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | (7-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) 2-(2-methylprop-2-enoylamino)acetate |
| SMILES | C=C(C)C(=O)NCC(=O)OC1C2CC3OS(=O)(=O)C1C3(C)C2 |
| InChI | InChI=1S/C14H19NO6S/c1-7(2)13(17)15-6-10(16)20-11-8-4-9-14(3,5-8)12(11)22(18,19)21-9/h8-9,11-12H,1,4-6H2,2-3H3,(H,15,17) |
| InChIKey | WIAMKPNAYPVJSH-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|