C14H18O10S — CID 59623246
[2-[[1,7-bis(hydroxymethyl)-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl]oxy]-2-oxoethyl] 2-methylprop-2-enoate (PubChem CID 59623246) has the molecular formula C14H18O10S and a molecular weight of 378.36 g/mol. Its IUPAC name is [2-[[1,7-bis(hydroxymethyl)-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl]oxy]-2-oxoethyl] 2-methylprop-2-enoate.
| Compound Name | [2-[[1,7-bis(hydroxymethyl)-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl]oxy]-2-oxoethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59623246 |
| Molecular Formula | C14H18O10S |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | [2-[[1,7-bis(hydroxymethyl)-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl]oxy]-2-oxoethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(=O)OC1C2C3(CO)OC1(CO)CC3OS2(=O)=O |
| InChI | InChI=1S/C14H18O10S/c1-7(2)12(18)21-4-9(17)22-10-11-14(6-16)8(23-25(11,19)20)3-13(10,5-15)24-14/h8,10-11,15-16H,1,3-6H2,2H3 |
| InChIKey | SDAOTXFBCKSJFS-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|