C19H24O11S — CID 59623421
[2-[[1,7-bis(acetyloxymethyl)-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2-oxoethyl] 2-methylprop-2-enoate (PubChem CID 59623421) has the molecular formula C19H24O11S and a molecular weight of 460.46 g/mol. Its IUPAC name is [2-[[1,7-bis(acetyloxymethyl)-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2-oxoethyl] 2-methylprop-2-enoate.
| Compound Name | [2-[[1,7-bis(acetyloxymethyl)-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2-oxoethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59623421 |
| Molecular Formula | C19H24O11S |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | [2-[[1,7-bis(acetyloxymethyl)-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2-oxoethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(=O)OC1C2OS(=O)(=O)C3CC1(COC(C)=O)CC23COC(C)=O |
| InChI | InChI=1S/C19H24O11S/c1-10(2)17(23)26-6-14(22)29-15-16-19(9-28-12(4)21)7-18(15,8-27-11(3)20)5-13(19)31(24,25)30-16/h13,15-16H,1,5-9H2,2-4H3 |
| InChIKey | LSJPSUGDNLLGLN-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|