C18H22O12S — CID 59623290
[2-[[1,7-bis(acetyloxymethyl)-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl]oxy]-2-oxoethyl] 2-methylprop-2-enoate (PubChem CID 59623290) has the molecular formula C18H22O12S and a molecular weight of 462.43 g/mol. Its IUPAC name is [2-[[1,7-bis(acetyloxymethyl)-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl]oxy]-2-oxoethyl] 2-methylprop-2-enoate.
| Compound Name | [2-[[1,7-bis(acetyloxymethyl)-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl]oxy]-2-oxoethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59623290 |
| Molecular Formula | C18H22O12S |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | [2-[[1,7-bis(acetyloxymethyl)-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl]oxy]-2-oxoethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(=O)OC1C2C3(COC(C)=O)OC1(COC(C)=O)CC3OS2(=O)=O |
| InChI | InChI=1S/C18H22O12S/c1-9(2)16(22)25-6-13(21)28-14-15-18(8-27-11(4)20)12(29-31(15,23)24)5-17(14,30-18)7-26-10(3)19/h12,14-15H,1,5-8H2,2-4H3 |
| InChIKey | UPNOCAHNFWANDW-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|