C16H20O10S — CID 58165613
[1,7-bis(2-formyloxyethyl)-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl] 2-methylprop-2-enoate (PubChem CID 58165613) has the molecular formula C16H20O10S and a molecular weight of 404.39 g/mol. Its IUPAC name is [1,7-bis(2-formyloxyethyl)-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl] 2-methylprop-2-enoate.
| Compound Name | [1,7-bis(2-formyloxyethyl)-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58165613 |
| Molecular Formula | C16H20O10S |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | [1,7-bis(2-formyloxyethyl)-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1C2C3(CCOC=O)OC1(CCOC=O)CC3OS2(=O)=O |
| InChI | InChI=1S/C16H20O10S/c1-10(2)14(19)24-12-13-16(4-6-23-9-18)11(25-27(13,20)21)7-15(12,26-16)3-5-22-8-17/h8-9,11-13H,1,3-7H2,2H3 |
| InChIKey | PTTBPBSMYARKBN-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|