C12H14O4 — CID 67606928
6,8-dioxatetracyclo[3.3.1.11,4.03,7]decan-9-yl 2-methylprop-2-enoate (PubChem CID 67606928) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is 6,8-dioxatetracyclo[3.3.1.11,4.03,7]decan-9-yl 2-methylprop-2-enoate.
| Compound Name | 6,8-dioxatetracyclo[3.3.1.11,4.03,7]decan-9-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 67606928 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 6,8-dioxatetracyclo[3.3.1.11,4.03,7]decan-9-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1C2OC3OC14CC3C2C4 |
| InChI | InChI=1S/C12H14O4/c1-5(2)10(13)15-9-8-6-3-12(9)4-7(6)11(14-8)16-12/h6-9,11H,1,3-4H2,2H3 |
| InChIKey | LGNOFJNDMGTESH-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|