C15H28NO2+ — CID 134380283
(1,1,2,2,6,6-hexamethylpiperidin-1-ium-4-yl) 2-methylprop-2-enoate (PubChem CID 134380283) has the molecular formula C15H28NO2+ and a molecular weight of 254.39 g/mol. Its IUPAC name is (1,1,2,2,6,6-hexamethylpiperidin-1-ium-4-yl) 2-methylprop-2-enoate.
| Compound Name | (1,1,2,2,6,6-hexamethylpiperidin-1-ium-4-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134380283 |
| Molecular Formula | C15H28NO2+ |
| Molecular Weight | 254.39 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | (1,1,2,2,6,6-hexamethylpiperidin-1-ium-4-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CC(C)(C)[N+](C)(C)C(C)(C)C1 |
| InChI | InChI=1S/C15H28NO2/c1-11(2)13(17)18-12-9-14(3,4)16(7,8)15(5,6)10-12/h12H,1,9-10H2,2-8H3/q+1 |
| InChIKey | ORMHQVVJYXJLHG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|