C17H33N3O2 — CID 174862427
piperidin-4-yl 2-methylprop-2-enoate;2,2,6,6-tetramethylpiperazine (PubChem CID 174862427) has the molecular formula C17H33N3O2 and a molecular weight of 311.47 g/mol. Its IUPAC name is piperidin-4-yl 2-methylprop-2-enoate;2,2,6,6-tetramethylpiperazine.
| Compound Name | piperidin-4-yl 2-methylprop-2-enoate;2,2,6,6-tetramethylpiperazine |
|---|---|
| PubChem CID | 174862427 |
| Molecular Formula | C17H33N3O2 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | piperidin-4-yl 2-methylprop-2-enoate;2,2,6,6-tetramethylpiperazine |
| SMILES | C=C(C)C(=O)OC1CCNCC1.CC1(C)CNCC(C)(C)N1 |
| InChI | InChI=1S/C9H15NO2.C8H18N2/c1-7(2)9(11)12-8-3-5-10-6-4-8;1-7(2)5-9-6-8(3,4)10-7/h8,10H,1,3-6H2,2H3;9-10H,5-6H2,1-4H3 |
| InChIKey | NSKARVPMDDILMN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|