C28H44N2O4S2 — CID 164769768
[2-ethenyl-1-[[2-ethenyl-2,6,6-trimethyl-4-(2-methylprop-2-enoyloxy)piperidin-1-yl]disulfanyl]-2,6,6-trimethylpiperidin-4-yl] 2-methylprop-2-enoate (PubChem CID 164769768) has the molecular formula C28H44N2O4S2 and a molecular weight of 536.80 g/mol. Its IUPAC name is [2-ethenyl-1-[[2-ethenyl-2,6,6-trimethyl-4-(2-methylprop-2-enoyloxy)piperidin-1-yl]disulfanyl]-2,6,6-trimethylpiperidin-4-yl] 2-methylprop-2-enoate.
| Compound Name | [2-ethenyl-1-[[2-ethenyl-2,6,6-trimethyl-4-(2-methylprop-2-enoyloxy)piperidin-1-yl]disulfanyl]-2,6,6-trimethylpiperidin-4-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 164769768 |
| Molecular Formula | C28H44N2O4S2 |
| Molecular Weight | 536.80 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | [2-ethenyl-1-[[2-ethenyl-2,6,6-trimethyl-4-(2-methylprop-2-enoyloxy)piperidin-1-yl]disulfanyl]-2,6,6-trimethylpiperidin-4-yl] 2-methylprop-2-enoate |
| SMILES | C=CC1(C)CC(OC(=O)C(=C)C)CC(C)(C)N1SSN1C(C)(C)CC(OC(=O)C(=C)C)CC1(C)C=C |
| InChI | InChI=1S/C28H44N2O4S2/c1-13-27(11)17-21(33-23(31)19(3)4)15-25(7,8)29(27)35-36-30-26(9,10)16-22(18-28(30,12)14-2)34-24(32)20(5)6/h13-14,21-22H,1-3,5,15-18H2,4,6-12H3 |
| InChIKey | JDFJGIRGVYCJFW-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.80 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|