C24H38N6O4 — CID 19991765
[1-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-2,2,6,6-tetramethylpiperidin-4-yl] 2-methylprop-2-enoate (PubChem CID 19991765) has the molecular formula C24H38N6O4 and a molecular weight of 474.61 g/mol. Its IUPAC name is [1-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-2,2,6,6-tetramethylpiperidin-4-yl] 2-methylprop-2-enoate.
| Compound Name | [1-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-2,2,6,6-tetramethylpiperidin-4-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 19991765 |
| Molecular Formula | C24H38N6O4 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | [1-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-2,2,6,6-tetramethylpiperidin-4-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CC(C)(C)N(c2nc(N3CCOCC3)nc(N3CCOCC3)n2)C(C)(C)C1 |
| InChI | InChI=1S/C24H38N6O4/c1-17(2)19(31)34-18-15-23(3,4)30(24(5,6)16-18)22-26-20(28-7-11-32-12-8-28)25-21(27-22)29-9-13-33-14-10-29/h18H,1,7-16H2,2-6H3 |
| InChIKey | IBMJJTIQRMRUKR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 93.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|