C27H42N2O6 — CID 141308414
bis(2,2,6,6-tetramethyl-1-prop-2-enoylpiperidin-4-yl) propanedioate (PubChem CID 141308414) has the molecular formula C27H42N2O6 and a molecular weight of 490.64 g/mol. Its IUPAC name is bis(2,2,6,6-tetramethyl-1-prop-2-enoylpiperidin-4-yl) propanedioate.
| Compound Name | bis(2,2,6,6-tetramethyl-1-prop-2-enoylpiperidin-4-yl) propanedioate |
|---|---|
| PubChem CID | 141308414 |
| Molecular Formula | C27H42N2O6 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.30 |
| IUPAC Name | bis(2,2,6,6-tetramethyl-1-prop-2-enoylpiperidin-4-yl) propanedioate |
| SMILES | C=CC(=O)N1C(C)(C)CC(OC(=O)CC(=O)OC2CC(C)(C)N(C(=O)C=C)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C27H42N2O6/c1-11-20(30)28-24(3,4)14-18(15-25(28,5)6)34-22(32)13-23(33)35-19-16-26(7,8)29(21(31)12-2)27(9,10)17-19/h11-12,18-19H,1-2,13-17H2,3-10H3 |
| InChIKey | VTUDPFLKLQZZCH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|