C32H59ClN2O6 — CID 158484355
2-methylprop-2-enoyl chloride;2,2,6,6-tetramethyl-1-propoxypiperidin-4-ol;(2,2,6,6-tetramethyl-1-propoxypiperidin-4-yl) 2-methylprop-2-enoate (PubChem CID 158484355) has the molecular formula C32H59ClN2O6 and a molecular weight of 603.29 g/mol. Its IUPAC name is 2-methylprop-2-enoyl chloride;2,2,6,6-tetramethyl-1-propoxypiperidin-4-ol;(2,2,6,6-tetramethyl-1-propoxypiperidin-4-yl) 2-methylprop-2-enoate.
| Compound Name | 2-methylprop-2-enoyl chloride;2,2,6,6-tetramethyl-1-propoxypiperidin-4-ol;(2,2,6,6-tetramethyl-1-propoxypiperidin-4-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 158484355 |
| Molecular Formula | C32H59ClN2O6 |
| Molecular Weight | 603.29 g/mol |
| Exact Mass | 602.41 |
| IUPAC Name | 2-methylprop-2-enoyl chloride;2,2,6,6-tetramethyl-1-propoxypiperidin-4-ol;(2,2,6,6-tetramethyl-1-propoxypiperidin-4-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Cl.C=C(C)C(=O)OC1CC(C)(C)N(OCCC)C(C)(C)C1.CCCON1C(C)(C)CC(O)CC1(C)C |
| InChI | InChI=1S/C16H29NO3.C12H25NO2.C4H5ClO/c1-8-9-19-17-15(4,5)10-13(11-16(17,6)7)20-14(18)12(2)3;1-6-7-15-13-11(2,3)8-10(14)9-12(13,4)5;1-3(2)4(5)6/h13H,2,8-11H2,1,3-7H3;10,14H,6-9H2,1-5H3;1H2,2H3 |
| InChIKey | HHXHNUZPISGQFQ-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.29 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|