C17H37NO2 — CID 143602726
ethane;1-hexoxy-2,2,6,6-tetramethylpiperidin-4-ol (PubChem CID 143602726) has the molecular formula C17H37NO2 and a molecular weight of 287.49 g/mol. Its IUPAC name is ethane;1-hexoxy-2,2,6,6-tetramethylpiperidin-4-ol.
| Compound Name | ethane;1-hexoxy-2,2,6,6-tetramethylpiperidin-4-ol |
|---|---|
| PubChem CID | 143602726 |
| Molecular Formula | C17H37NO2 |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.28 |
| IUPAC Name | ethane;1-hexoxy-2,2,6,6-tetramethylpiperidin-4-ol |
| SMILES | CC.CCCCCCON1C(C)(C)CC(O)CC1(C)C |
| InChI | InChI=1S/C15H31NO2.C2H6/c1-6-7-8-9-10-18-16-14(2,3)11-13(17)12-15(16,4)5;1-2/h13,17H,6-12H2,1-5H3;1-2H3 |
| InChIKey | XGTJRWOPIJMTAN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|